C9H11IO3 — CID 10851298
(1S,2R,6R,7R)-1-(iodomethyl)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 10851298) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (1S,2R,6R,7R)-1-(iodomethyl)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2R,6R,7R)-1-(iodomethyl)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 10851298 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (1S,2R,6R,7R)-1-(iodomethyl)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1OC[C@H]2[C@@H]1[C@]1(CI)CC[C@H]2O1 |
| InChI | InChI=1S/C9H11IO3/c10-4-9-2-1-6(13-9)5-3-12-8(11)7(5)9/h5-7H,1-4H2/t5-,6-,7+,9-/m1/s1 |
| InChIKey | MOXIZEAQOWMJIE-JAGXHNFQSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|