C15H18N4O6 — CID 108513058
N-(2-methoxy-4-nitrophenyl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108513058) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108513058 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C15H18N4O6/c1-25-12-8-10(19(23)24)2-3-11(12)17-14(21)15(22)18-13(20)9-4-6-16-7-5-9/h2-3,8-9,16H,4-7H2,1H3,(H,17,21)(H,18,20,22) |
| InChIKey | LNXAYBICBDFPBT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|