About methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate
methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate (PubChem CID 10851309) has the molecular formula C15H16F2N2O2
and a molecular weight of 294.30 g/mol. Its IUPAC name is methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate |
| PubChem CID | 10851309 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(F)ccc2c1[C@@H]1CNCC[C@H]1F |
| InChI | InChI=1S/C15H16F2N2O2/c1-21-15(20)14-13(10-7-18-5-4-11(10)17)9-3-2-8(16)6-12(9)19-14/h2-3,6,10-11,18-19H,4-5,7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | CJPSOUOLAPMNQT-GHMZBOCLSA-N |
| XLogP | 2.51 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate?
The IUPAC name of methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate (CID 10851309) is methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate?
The canonical SMILES for methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate is COC(=O)c1[nH]c2cc(F)ccc2c1[C@@H]1CNCC[C@H]1F.
What is the InChIKey of methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate?
The InChIKey is CJPSOUOLAPMNQT-GHMZBOCLSA-N. The full InChI is InChI=1S/C15H16F2N2O2/c1-21-15(20)14-13(10-7-18-5-4-11(10)17)9-3-2-8(16)6-12(9)19-14/h2-3,6,10-11,18-19H,4-5,7H2,1H3/t10-,11-/m1/s1.
What are the key properties of methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate?
methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate has a molecular weight of 294.30 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-fluoro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-1H-indole-2-carboxylate is sourced from PubChem (CID 10851309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).