About N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide
N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide (PubChem CID 10851315) has the molecular formula C13H18N4O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide.
Molecular Properties
| Compound Name | N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide |
| PubChem CID | 10851315 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide |
| SMILES | CNC(=O)C(CCn1cc(C)c(=O)[nH]c1=O)N1CCC1=O |
| InChI | InChI=1S/C13H18N4O4/c1-8-7-16(13(21)15-11(8)19)5-3-9(12(20)14-2)17-6-4-10(17)18/h7,9H,3-6H2,1-2H3,(H,14,20)(H,15,19,21) |
| InChIKey | CMMGEGMPLTVKKP-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide?
The IUPAC name of N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide (CID 10851315) is N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide.
What is the SMILES notation for N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide?
The canonical SMILES for N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide is CNC(=O)C(CCn1cc(C)c(=O)[nH]c1=O)N1CCC1=O.
What is the InChIKey of N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide?
The InChIKey is CMMGEGMPLTVKKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O4/c1-8-7-16(13(21)15-11(8)19)5-3-9(12(20)14-2)17-6-4-10(17)18/h7,9H,3-6H2,1-2H3,(H,14,20)(H,15,19,21).
What are the key properties of N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide?
N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide has a molecular weight of 294.31 g/mol, XLogP of -1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-oxoazetidin-1-yl)butanamide is sourced from PubChem (CID 10851315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).