About (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate
(4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 10851367) has the molecular formula C12H15BFN3O2S
and a molecular weight of 295.15 g/mol. Its IUPAC name is (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
| PubChem CID | 10851367 |
| Molecular Formula | C12H15BFN3O2S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | CC1CCOB(S/C(N)=N\N=C/c2ccccc2F)O1 |
| InChI | InChI=1S/C12H15BFN3O2S/c1-9-6-7-18-13(19-9)20-12(15)17-16-8-10-4-2-3-5-11(10)14/h2-5,8-9H,6-7H2,1H3,(H2,15,17)/b16-8- |
| InChIKey | TWRSUFYFWVUPEM-PXNMLYILSA-N |
| XLogP | 2.02 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate?
The IUPAC name of (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate (CID 10851367) is (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate.
What is the SMILES notation for (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate?
The canonical SMILES for (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate is CC1CCOB(S/C(N)=N\N=C/c2ccccc2F)O1.
What is the InChIKey of (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate?
The InChIKey is TWRSUFYFWVUPEM-PXNMLYILSA-N. The full InChI is InChI=1S/C12H15BFN3O2S/c1-9-6-7-18-13(19-9)20-12(15)17-16-8-10-4-2-3-5-11(10)14/h2-5,8-9H,6-7H2,1H3,(H2,15,17)/b16-8-.
What are the key properties of (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate?
(4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate has a molecular weight of 295.15 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3,2-dioxaborinan-2-yl) N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate is sourced from PubChem (CID 10851367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).