C13H16N2O3 — CID 108514226
N-(2-hydroxyphenyl)-2-oxo-2-piperidin-1-ylacetamide (PubChem CID 108514226) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-oxo-2-piperidin-1-ylacetamide.
| Compound Name | N-(2-hydroxyphenyl)-2-oxo-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 108514226 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-oxo-2-piperidin-1-ylacetamide |
| SMILES | O=C(Nc1ccccc1O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H16N2O3/c16-11-7-3-2-6-10(11)14-12(17)13(18)15-8-4-1-5-9-15/h2-3,6-7,16H,1,4-5,8-9H2,(H,14,17) |
| InChIKey | LZRGXCZYLNLEBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|