C14H15N6O2+ — CID 10851604
1,5,7-trimethyl-N-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-4-ium-3-amine (PubChem CID 10851604) has the molecular formula C14H15N6O2+ and a molecular weight of 299.31 g/mol. Its IUPAC name is 1,5,7-trimethyl-N-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-4-ium-3-amine.
| Compound Name | 1,5,7-trimethyl-N-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-4-ium-3-amine |
|---|---|
| PubChem CID | 10851604 |
| Molecular Formula | C14H15N6O2+ |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1,5,7-trimethyl-N-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-4-ium-3-amine |
| SMILES | Cc1cc2n(C)nc(Nc3ccc([N+](=O)[O-])cc3)[n+]2c(C)n1 |
| InChI | InChI=1S/C14H15N6O2/c1-9-8-13-18(3)17-14(19(13)10(2)15-9)16-11-4-6-12(7-5-11)20(21)22/h4-8H,1-3H3,(H,16,17)/q+1 |
| InChIKey | ZFZPZJGQYBVMOW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|