C16H16ClN3O2 — CID 108516205
N-(4-amino-3-chlorophenyl)-N'-(3,5-dimethylphenyl)oxamide (PubChem CID 108516205) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-N'-(3,5-dimethylphenyl)oxamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-N'-(3,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108516205 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-N'-(3,5-dimethylphenyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)Nc2ccc(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-9-5-10(2)7-12(6-9)20-16(22)15(21)19-11-3-4-14(18)13(17)8-11/h3-8H,18H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | FZWBLQYAXLJARE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|