C18H34O3 — CID 10851658
(1R,2S,3S,5R)-6,6-dimethyl-2-(octoxymethyl)bicyclo[3.1.1]heptane-2,3-diol (PubChem CID 10851658) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (1R,2S,3S,5R)-6,6-dimethyl-2-(octoxymethyl)bicyclo[3.1.1]heptane-2,3-diol.
| Compound Name | (1R,2S,3S,5R)-6,6-dimethyl-2-(octoxymethyl)bicyclo[3.1.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 10851658 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (1R,2S,3S,5R)-6,6-dimethyl-2-(octoxymethyl)bicyclo[3.1.1]heptane-2,3-diol |
| SMILES | CCCCCCCCOC[C@@]1(O)[C@@H]2C[C@H](C[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C18H34O3/c1-4-5-6-7-8-9-10-21-13-18(20)15-11-14(12-16(18)19)17(15,2)3/h14-16,19-20H,4-13H2,1-3H3/t14-,15-,16+,18-/m1/s1 |
| InChIKey | ZDNUYLQPIPKKLL-XLMAVXFVSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|