C16H20N2O2 — CID 108516722
N-ethyl-N-phenyl-N',N'-bis(prop-2-enyl)oxamide (PubChem CID 108516722) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-ethyl-N-phenyl-N',N'-bis(prop-2-enyl)oxamide.
| Compound Name | N-ethyl-N-phenyl-N',N'-bis(prop-2-enyl)oxamide |
|---|---|
| PubChem CID | 108516722 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-ethyl-N-phenyl-N',N'-bis(prop-2-enyl)oxamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2/c1-4-12-17(13-5-2)15(19)16(20)18(6-3)14-10-8-7-9-11-14/h4-5,7-11H,1-2,6,12-13H2,3H3 |
| InChIKey | SOLGGNOMVFXMNF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|