C16H25N3O3 — CID 108517632
N-(furan-2-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108517632) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108517632 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)NCc2ccco2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H25N3O3/c1-15(2)8-11(9-16(3,4)19-15)18-14(21)13(20)17-10-12-6-5-7-22-12/h5-7,11,19H,8-10H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | BIZDJOBHPSWUEI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|