C14H21N3O4S — CID 108520263
N-pentyl-N'-[(4-sulfamoylphenyl)methyl]oxamide (PubChem CID 108520263) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-pentyl-N'-[(4-sulfamoylphenyl)methyl]oxamide.
| Compound Name | N-pentyl-N'-[(4-sulfamoylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108520263 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-pentyl-N'-[(4-sulfamoylphenyl)methyl]oxamide |
| SMILES | CCCCCNC(=O)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O4S/c1-2-3-4-9-16-13(18)14(19)17-10-11-5-7-12(8-6-11)22(15,20)21/h5-8H,2-4,9-10H2,1H3,(H,16,18)(H,17,19)(H2,15,20,21) |
| InChIKey | MZRQCFLZQVXCLS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|