C20H32O2 — CID 10852076
3-[(E)-5-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 10852076) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 3-[(E)-5-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-methylpent-3-enyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(E)-5-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 10852076 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 3-[(E)-5-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\COCC1=CC[C@@H]2C[C@H]1C2(C)C)CCC1OC1(C)C |
| InChI | InChI=1S/C20H32O2/c1-14(6-9-18-20(4,5)22-18)10-11-21-13-15-7-8-16-12-17(15)19(16,2)3/h7,10,16-18H,6,8-9,11-13H2,1-5H3/b14-10+/t16-,17-,18?/m1/s1 |
| InChIKey | APKIIFBECQVFFK-OIHPHWBWSA-N |
| XLogP | 4.90 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|