C19H28OS — CID 10852078
(E)-benzylidene-[(1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methyl-λ4-sulfane (PubChem CID 10852078) has the molecular formula C19H28OS and a molecular weight of 304.50 g/mol. Its IUPAC name is (E)-benzylidene-[(1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methyl-λ4-sulfane.
| Compound Name | (E)-benzylidene-[(1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methyl-λ4-sulfane |
|---|---|
| PubChem CID | 10852078 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (E)-benzylidene-[(1S,2R,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methyl-λ4-sulfane |
| SMILES | CO[C@@H]1[C@H](/S(C)=C/c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C19H28OS/c1-18(2)15-11-12-19(18,3)17(20-4)16(15)21(5)13-14-9-7-6-8-10-14/h6-10,13,15-17H,11-12H2,1-5H3/t15-,16-,17-,19+,21?/m1/s1 |
| InChIKey | XHCVBBRUKQBOAD-CCBATKRSSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|