C18H35N3O2 — CID 108521516
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-butyl-2-oxo-N-propylacetamide (PubChem CID 108521516) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-butyl-2-oxo-N-propylacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-butyl-2-oxo-N-propylacetamide |
|---|---|
| PubChem CID | 108521516 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-butyl-2-oxo-N-propylacetamide |
| SMILES | CCCCN(CCC)C(=O)C(=O)N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C18H35N3O2/c1-7-9-11-20(10-8-2)15(22)16(23)21-17(3,4)12-14(19)13-18(21,5)6/h14H,7-13,19H2,1-6H3 |
| InChIKey | VPJVMDSQKSBCEL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|