C20H31N3O4 — CID 108522545
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-2-oxoacetamide (PubChem CID 108522545) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108522545 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-2-oxoacetamide |
| SMILES | COc1ccc(OCCNC(=O)C(=O)N2C(C)(C)CC(N)CC2(C)C)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-19(2)12-14(21)13-20(3,4)23(19)18(25)17(24)22-10-11-27-16-8-6-15(26-5)7-9-16/h6-9,14H,10-13,21H2,1-5H3,(H,22,24) |
| InChIKey | NGRDMMSDPPDJMJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|