C15H28N4O3 — CID 108522547
N-acetyl-N-(2-aminoethyl)-2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108522547) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-acetyl-N-(2-aminoethyl)-2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-acetyl-N-(2-aminoethyl)-2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108522547 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-acetyl-N-(2-aminoethyl)-2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | CC(=O)N(CCN)C(=O)C(=O)N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C15H28N4O3/c1-10(20)18(7-6-16)12(21)13(22)19-14(2,3)8-11(17)9-15(19,4)5/h11H,6-9,16-17H2,1-5H3 |
| InChIKey | WSJZQMRUYHYVLI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|