About (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone (PubChem CID 10852345) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone |
| PubChem CID | 10852345 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone |
| SMILES | CC(C)(C)c1cc(C(=O)c2ccccc2)cc2c1OCC2(C)C |
| InChI | InChI=1S/C21H24O2/c1-20(2,3)16-11-15(18(22)14-9-7-6-8-10-14)12-17-19(16)23-13-21(17,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | YFUHWDPSKXJUAK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone?
The IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone (CID 10852345) is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone.
What is the SMILES notation for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone?
The canonical SMILES for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone is CC(C)(C)c1cc(C(=O)c2ccccc2)cc2c1OCC2(C)C.
What is the InChIKey of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone?
The InChIKey is YFUHWDPSKXJUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O2/c1-20(2,3)16-11-15(18(22)14-9-7-6-8-10-14)12-17-19(16)23-13-21(17,4)5/h6-12H,13H2,1-5H3.
What are the key properties of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone?
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone has a molecular weight of 308.42 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-phenylmethanone is sourced from PubChem (CID 10852345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).