About ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate
ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 10852518) has the molecular formula C16H25NO5
and a molecular weight of 311.38 g/mol. Its IUPAC name is ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 10852518 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C1\C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C16H25NO5/c1-8-10-9-11(13(19)21-15(2,3)4)17(12(10)18)14(20)22-16(5,6)7/h8,11H,9H2,1-7H3/b10-8+/t11-/m0/s1 |
| InChIKey | SNRPBBVNGUXUGP-UQSGXBNBSA-N |
| XLogP | 2.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate (CID 10852518) is ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate is C/C=C1\C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1=O.
What is the InChIKey of ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is SNRPBBVNGUXUGP-UQSGXBNBSA-N. The full InChI is InChI=1S/C16H25NO5/c1-8-10-9-11(13(19)21-15(2,3)4)17(12(10)18)14(20)22-16(5,6)7/h8,11H,9H2,1-7H3/b10-8+/t11-/m0/s1.
What are the key properties of ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate?
ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 311.38 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S,4E)-4-ethylidene-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 10852518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).