C11H5ClN2O3S2 — CID 10852631
5-(7-chlorothieno[2,3-f][1,3]benzodioxol-6-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 10852631) has the molecular formula C11H5ClN2O3S2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 5-(7-chlorothieno[2,3-f][1,3]benzodioxol-6-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(7-chlorothieno[2,3-f][1,3]benzodioxol-6-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 10852631 |
| Molecular Formula | C11H5ClN2O3S2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 5-(7-chlorothieno[2,3-f][1,3]benzodioxol-6-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2sc3cc4c(cc3c2Cl)OCO4)o1 |
| InChI | InChI=1S/C11H5ClN2O3S2/c12-8-4-1-5-6(16-3-15-5)2-7(4)19-9(8)10-13-14-11(18)17-10/h1-2H,3H2,(H,14,18) |
| InChIKey | RMWXVXQNQMCXHP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|