About 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol
11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol (PubChem CID 10852775) has the molecular formula C19H22O2S
and a molecular weight of 314.45 g/mol. Its IUPAC name is 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol.
Molecular Properties
| Compound Name | 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol |
| PubChem CID | 10852775 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol |
| SMILES | C=C(C#CCCCCOC)C(O)C#CCSc1ccccc1 |
| InChI | InChI=1S/C19H22O2S/c1-17(11-6-3-4-9-15-21-2)19(20)14-10-16-22-18-12-7-5-8-13-18/h5,7-8,12-13,19-20H,1,3-4,9,15-16H2,2H3 |
| InChIKey | XOQZOSKQOIYYQE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol?
The IUPAC name of 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol (CID 10852775) is 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol.
What is the SMILES notation for 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol?
The canonical SMILES for 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol is C=C(C#CCCCCOC)C(O)C#CCSc1ccccc1.
What is the InChIKey of 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol?
The InChIKey is XOQZOSKQOIYYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2S/c1-17(11-6-3-4-9-15-21-2)19(20)14-10-16-22-18-12-7-5-8-13-18/h5,7-8,12-13,19-20H,1,3-4,9,15-16H2,2H3.
What are the key properties of 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol?
11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol has a molecular weight of 314.45 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methoxy-5-methylidene-1-phenylsulfanylundeca-2,6-diyn-4-ol is sourced from PubChem (CID 10852775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).