C18H36O4 — CID 10852911
2,3-dihydroxypropyl 13-methyltetradecanoate (PubChem CID 10852911) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 13-methyltetradecanoate.
| Compound Name | 2,3-dihydroxypropyl 13-methyltetradecanoate |
|---|---|
| PubChem CID | 10852911 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 2,3-dihydroxypropyl 13-methyltetradecanoate |
| SMILES | CC(C)CCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C18H36O4/c1-16(2)12-10-8-6-4-3-5-7-9-11-13-18(21)22-15-17(20)14-19/h16-17,19-20H,3-15H2,1-2H3 |
| InChIKey | CALSYPDGGJMMDZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|