C19H29NO3 — CID 10853083
(3aS,4S,5R,6R,6aR)-5-benzyl-4-tert-butyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 10853083) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (3aS,4S,5R,6R,6aR)-5-benzyl-4-tert-butyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aS,4S,5R,6R,6aR)-5-benzyl-4-tert-butyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 10853083 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (3aS,4S,5R,6R,6aR)-5-benzyl-4-tert-butyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](C(C)(C)C)[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-13-15-16(23-19(5,6)22-15)17(18(2,3)4)20(13,21)12-14-10-8-7-9-11-14/h7-11,13,15-17H,12H2,1-6H3/t13-,15-,16-,17-,20-/m1/s1 |
| InChIKey | OLLSCLOAIOIWNR-DIYQJYNUSA-N |
| XLogP | 3.84 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|