About 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one
5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one (PubChem CID 10853185) has the molecular formula C15H10F3N3O2
and a molecular weight of 321.26 g/mol. Its IUPAC name is 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one.
Molecular Properties
| Compound Name | 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one |
| PubChem CID | 10853185 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one |
| SMILES | Nc1ccc(-c2cc(=O)c3c(N)c(F)c(N)c(F)c3o2)cc1F |
| InChI | InChI=1S/C15H10F3N3O2/c16-6-3-5(1-2-7(6)19)9-4-8(22)10-13(20)11(17)14(21)12(18)15(10)23-9/h1-4H,19-21H2 |
| InChIKey | OGNVTJFDXCPTEJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one?
The IUPAC name of 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one (CID 10853185) is 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one.
What is the SMILES notation for 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one?
The canonical SMILES for 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one is Nc1ccc(-c2cc(=O)c3c(N)c(F)c(N)c(F)c3o2)cc1F.
What is the InChIKey of 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one?
The InChIKey is OGNVTJFDXCPTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O2/c16-6-3-5(1-2-7(6)19)9-4-8(22)10-13(20)11(17)14(21)12(18)15(10)23-9/h1-4H,19-21H2.
What are the key properties of 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one?
5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one has a molecular weight of 321.26 g/mol, XLogP of 2.62, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-diamino-2-(4-amino-3-fluorophenyl)-6,8-difluorochromen-4-one is sourced from PubChem (CID 10853185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).