About dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate
dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate (PubChem CID 10853553) has the molecular formula C15H22N2O6
and a molecular weight of 326.35 g/mol. Its IUPAC name is dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate |
| PubChem CID | 10853553 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C)n(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C15H22N2O6/c1-8-10(12(18)21-6)11(13(19)22-7)9(2)17(8)16-14(20)23-15(3,4)5/h1-7H3,(H,16,20) |
| InChIKey | NMJUXJADPCEVBZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate?
The IUPAC name of dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate (CID 10853553) is dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate?
The canonical SMILES for dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate is COC(=O)c1c(C(=O)OC)c(C)n(NC(=O)OC(C)(C)C)c1C.
What is the InChIKey of dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate?
The InChIKey is NMJUXJADPCEVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O6/c1-8-10(12(18)21-6)11(13(19)22-7)9(2)17(8)16-14(20)23-15(3,4)5/h1-7H3,(H,16,20).
What are the key properties of dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate?
dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate has a molecular weight of 326.35 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3,4-dicarboxylate is sourced from PubChem (CID 10853553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).