About [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride
[(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride (PubChem CID 10853616) has the molecular formula C16H23ClN2O3
and a molecular weight of 326.82 g/mol. Its IUPAC name is [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride.
Molecular Properties
| Compound Name | [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride |
| PubChem CID | 10853616 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride |
| SMILES | CCN(CC)C(=O)[C@@]1(c2ccccc2)C[C@H]1[C@@H]([NH3+])C(=O)O.[Cl-] |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-3-18(4-2)15(21)16(11-8-6-5-7-9-11)10-12(16)13(17)14(19)20;/h5-9,12-13H,3-4,10,17H2,1-2H3,(H,19,20);1H/t12-,13+,16+;/m0./s1 |
| InChIKey | HMGINEKQQMSGTH-ROHNBLDBSA-N |
| XLogP | -2.49 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride?
The IUPAC name of [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride (CID 10853616) is [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride.
What is the SMILES notation for [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride?
The canonical SMILES for [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride is CCN(CC)C(=O)[C@@]1(c2ccccc2)C[C@H]1[C@@H]([NH3+])C(=O)O.[Cl-].
What is the InChIKey of [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride?
The InChIKey is HMGINEKQQMSGTH-ROHNBLDBSA-N. The full InChI is InChI=1S/C16H22N2O3.ClH/c1-3-18(4-2)15(21)16(11-8-6-5-7-9-11)10-12(16)13(17)14(19)20;/h5-9,12-13H,3-4,10,17H2,1-2H3,(H,19,20);1H/t12-,13+,16+;/m0./s1.
What are the key properties of [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride?
[(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride has a molecular weight of 326.82 g/mol, XLogP of -2.49, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(R)-carboxy-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methyl]azanium chloride is sourced from PubChem (CID 10853616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).