C16H23BrO2 — CID 10853629
6-bromo-7-(methoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 10853629) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 6-bromo-7-(methoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-bromo-7-(methoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 10853629 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 6-bromo-7-(methoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | COCOc1cc2c(cc1Br)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C16H23BrO2/c1-15(2)6-7-16(3,4)12-9-14(19-10-18-5)13(17)8-11(12)15/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | BPEONMBGNDPSON-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|