C18H32N4O5 — CID 108537211
tert-butyl N-[3-oxo-3-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethylamino]propyl]carbamate (PubChem CID 108537211) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108537211 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethylamino]propyl]carbamate |
| SMILES | CC(C)N1CC(C(=O)NCCNC(=O)CCNC(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C18H32N4O5/c1-12(2)22-11-13(10-15(22)24)16(25)20-9-8-19-14(23)6-7-21-17(26)27-18(3,4)5/h12-13H,6-11H2,1-5H3,(H,19,23)(H,20,25)(H,21,26) |
| InChIKey | DJSRZFJUDRXCTC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|