C20H29N3O5 — CID 108538746
1-tert-butyl-N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 108538746) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-tert-butyl-N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108538746 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-tert-butyl-N-[2-[(2,6-dimethoxybenzoyl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCNC(=O)C1CC(=O)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2,3)23-12-13(11-16(23)24)18(25)21-9-10-22-19(26)17-14(27-4)7-6-8-15(17)28-5/h6-8,13H,9-12H2,1-5H3,(H,21,25)(H,22,26) |
| InChIKey | ZXIHNMUEBGRAHA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|