C19H27N3O3 — CID 108540941
N-[2-(2-methylpropanoylamino)ethyl]-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 108540941) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108540941 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)C1CC(=O)N(C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-13(2)18(24)20-9-10-21-19(25)16-11-17(23)22(12-16)14(3)15-7-5-4-6-8-15/h4-8,13-14,16H,9-12H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | KCVFAZIQAISZPY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|