C19H25N3O4 — CID 108541036
1-benzyl-5-oxo-N-[2-(oxolane-2-carbonylamino)ethyl]pyrrolidine-3-carboxamide (PubChem CID 108541036) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-benzyl-5-oxo-N-[2-(oxolane-2-carbonylamino)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-5-oxo-N-[2-(oxolane-2-carbonylamino)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108541036 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-benzyl-5-oxo-N-[2-(oxolane-2-carbonylamino)ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCO1)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25N3O4/c23-17-11-15(13-22(17)12-14-5-2-1-3-6-14)18(24)20-8-9-21-19(25)16-7-4-10-26-16/h1-3,5-6,15-16H,4,7-13H2,(H,20,24)(H,21,25) |
| InChIKey | PTSHOZMVZFKPOJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|