C20H24N2O2 — CID 10854213
2,3-bis(dimethylamino)-1,4-bis(2,3,4,5,6-pentadeuteriophenyl)butane-1,4-dione (PubChem CID 10854213) has the molecular formula C20H24N2O2 and a molecular weight of 334.49 g/mol. Its IUPAC name is 2,3-bis(dimethylamino)-1,4-bis(2,3,4,5,6-pentadeuteriophenyl)butane-1,4-dione.
| Compound Name | 2,3-bis(dimethylamino)-1,4-bis(2,3,4,5,6-pentadeuteriophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 10854213 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2,3-bis(dimethylamino)-1,4-bis(2,3,4,5,6-pentadeuteriophenyl)butane-1,4-dione |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)C(C(C(=O)c2c([2H])c([2H])c([2H])c([2H])c2[2H])N(C)C)N(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C20H24N2O2/c1-21(2)17(19(23)15-11-7-5-8-12-15)18(22(3)4)20(24)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3/i5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| InChIKey | JPPORXGMUJHWKP-FBOMCFBCSA-N |
| XLogP | 2.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |