C17H19ClN2O3 — CID 10854227
ethyl 4-(4-chlorophenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate (PubChem CID 10854227) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10854227 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(-c2ccc(Cl)cc2)c1N1CCOCC1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-2-23-17(21)15-16(20-7-9-22-10-8-20)14(11-19-15)12-3-5-13(18)6-4-12/h3-6,11,19H,2,7-10H2,1H3 |
| InChIKey | BKUMFSQRFJSRFA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |