C28H30N2O2 — CID 108544301
3-(4-methylphenyl)-1-[4-(4-phenylbenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 108544301) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[4-(4-phenylbenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-(4-methylphenyl)-1-[4-(4-phenylbenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108544301 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-(4-methylphenyl)-1-[4-(4-phenylbenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | Cc1ccc(CCC(=O)N2CCCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-22-8-10-23(11-9-22)12-17-27(31)29-18-5-19-30(21-20-29)28(32)26-15-13-25(14-16-26)24-6-3-2-4-7-24/h2-4,6-11,13-16H,5,12,17-21H2,1H3 |
| InChIKey | HPOOINMYIXGTFG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |