C23H27N3O5 — CID 108544969
N-[2-[4-(3,5-dimethoxybenzoyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide (PubChem CID 108544969) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[2-[4-(3,5-dimethoxybenzoyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4-(3,5-dimethoxybenzoyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108544969 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[2-[4-(3,5-dimethoxybenzoyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCCN(C(=O)CNC(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-19-13-18(14-20(15-19)31-2)23(29)26-10-6-9-25(11-12-26)21(27)16-24-22(28)17-7-4-3-5-8-17/h3-5,7-8,13-15H,6,9-12,16H2,1-2H3,(H,24,28) |
| InChIKey | SKPCLMLEKRUNMA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |