C18H30O2SSi — CID 10854525
(2S,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylsulfanylhex-5-en-3-ol (PubChem CID 10854525) has the molecular formula C18H30O2SSi and a molecular weight of 338.59 g/mol. Its IUPAC name is (2S,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylsulfanylhex-5-en-3-ol.
| Compound Name | (2S,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylsulfanylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10854525 |
| Molecular Formula | C18H30O2SSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2S,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylsulfanylhex-5-en-3-ol |
| SMILES | C=C[C@@H](Sc1ccccc1)[C@@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O2SSi/c1-8-16(21-15-12-10-9-11-13-15)17(19)14(2)20-22(6,7)18(3,4)5/h8-14,16-17,19H,1H2,2-7H3/t14-,16+,17-/m0/s1 |
| InChIKey | RVRPWRQWPMCXAR-UAGQMJEPSA-N |
| XLogP | 5.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|