C21H25NO3 — CID 10854580
(3R,4S)-3-(4-benzylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol (PubChem CID 10854580) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3R,4S)-3-(4-benzylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol.
| Compound Name | (3R,4S)-3-(4-benzylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol |
|---|---|
| PubChem CID | 10854580 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (3R,4S)-3-(4-benzylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol |
| SMILES | Oc1ccc2c(c1)OC[C@@H](N1CCC(Cc3ccccc3)CC1)[C@H]2O |
| InChI | InChI=1S/C21H25NO3/c23-17-6-7-18-20(13-17)25-14-19(21(18)24)22-10-8-16(9-11-22)12-15-4-2-1-3-5-15/h1-7,13,16,19,21,23-24H,8-12,14H2/t19-,21+/m1/s1 |
| InChIKey | LBWGGMZSOYQNAK-CTNGQTDRSA-N |
| XLogP | 3.14 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |