C12H12Cl2FNO3S — CID 10854607
(4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 10854607) has the molecular formula C12H12Cl2FNO3S and a molecular weight of 340.20 g/mol. Its IUPAC name is (4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10854607 |
| Molecular Formula | C12H12Cl2FNO3S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ccc([C@H]2OC(C(Cl)Cl)=N[C@@H]2CF)cc1 |
| InChI | InChI=1S/C12H12Cl2FNO3S/c1-20(17,18)8-4-2-7(3-5-8)10-9(6-15)16-12(19-10)11(13)14/h2-5,9-11H,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | VANTWUZULFVTRN-NXEZZACHSA-N |
| XLogP | 2.70 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|