C18H21F3N2O3 — CID 108547592
1-[4-[2-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]pentane-1,4-dione (PubChem CID 108547592) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[4-[2-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-[2-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 108547592 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[4-[2-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H21F3N2O3/c1-13(24)7-8-16(25)22-9-4-10-23(12-11-22)17(26)14-5-2-3-6-15(14)18(19,20)21/h2-3,5-6H,4,7-12H2,1H3 |
| InChIKey | DUIXEQIBPQZNCR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |