About 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline
4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline (PubChem CID 10854761) has the molecular formula C16H17Cl2NOS
and a molecular weight of 342.29 g/mol. Its IUPAC name is 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline.
Molecular Properties
| Compound Name | 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline |
| PubChem CID | 10854761 |
| Molecular Formula | C16H17Cl2NOS |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline |
| SMILES | O=S(c1ccccc1)c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H17Cl2NOS/c17-10-12-19(13-11-18)14-6-8-16(9-7-14)21(20)15-4-2-1-3-5-15/h1-9H,10-13H2 |
| InChIKey | HABZZOWWXDUDHE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline?
The IUPAC name of 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline (CID 10854761) is 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline.
What is the SMILES notation for 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline?
The canonical SMILES for 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline is O=S(c1ccccc1)c1ccc(N(CCCl)CCCl)cc1.
What is the InChIKey of 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline?
The InChIKey is HABZZOWWXDUDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2NOS/c17-10-12-19(13-11-18)14-6-8-16(9-7-14)21(20)15-4-2-1-3-5-15/h1-9H,10-13H2.
What are the key properties of 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline?
4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline has a molecular weight of 342.29 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfinyl)-N,N-bis(2-chloroethyl)aniline is sourced from PubChem (CID 10854761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).