C20H13ClN4O3 — CID 1085481
ethyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 1085481) has the molecular formula C20H13ClN4O3 and a molecular weight of 392.80 g/mol. Its IUPAC name is ethyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 1085481 |
| Molecular Formula | C20H13ClN4O3 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | ethyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=C(\C#N)C(N)=C(C#N)C#N)o2)ccc1Cl |
| InChI | InChI=1S/C20H13ClN4O3/c1-2-27-20(26)16-8-12(3-5-17(16)21)18-6-4-15(28-18)7-13(9-22)19(25)14(10-23)11-24/h3-8H,2,25H2,1H3/b13-7+ |
| InChIKey | BDHFAUFVCALZDL-NTUHNPAUSA-N |
| XLogP | 3.94 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|