C24H30N2O5 — CID 108549245
N-[1-[3-(3,4-dimethoxyphenyl)propanoyl]piperidin-4-yl]-2-methoxybenzamide (PubChem CID 108549245) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[1-[3-(3,4-dimethoxyphenyl)propanoyl]piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[3-(3,4-dimethoxyphenyl)propanoyl]piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108549245 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[1-[3-(3,4-dimethoxyphenyl)propanoyl]piperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(CCC(=O)N2CCC(NC(=O)c3ccccc3OC)CC2)cc1OC |
| InChI | InChI=1S/C24H30N2O5/c1-29-20-7-5-4-6-19(20)24(28)25-18-12-14-26(15-13-18)23(27)11-9-17-8-10-21(30-2)22(16-17)31-3/h4-8,10,16,18H,9,11-15H2,1-3H3,(H,25,28) |
| InChIKey | YUYYEWDBALVQFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |