C24H30N2O6 — CID 108549305
3,4,5-trimethoxy-N-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]benzamide (PubChem CID 108549305) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108549305 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C(=O)COc3ccc(C)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N2O6/c1-16-5-7-19(8-6-16)32-15-22(27)26-11-9-18(10-12-26)25-24(28)17-13-20(29-2)23(31-4)21(14-17)30-3/h5-8,13-14,18H,9-12,15H2,1-4H3,(H,25,28) |
| InChIKey | LYHKVPMSBNOTFK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |