C25H25N3O2 — CID 108549584
2,2-diphenyl-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]acetamide (PubChem CID 108549584) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2,2-diphenyl-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2,2-diphenyl-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108549584 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2,2-diphenyl-N-[1-(pyridine-3-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(NC1CCN(C(=O)c2cccnc2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O2/c29-24(23(19-8-3-1-4-9-19)20-10-5-2-6-11-20)27-22-13-16-28(17-14-22)25(30)21-12-7-15-26-18-21/h1-12,15,18,22-23H,13-14,16-17H2,(H,27,29) |
| InChIKey | IBWMPVAIKKSIEH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |