C20H23N3O4 — CID 108551204
2-(4-hydroxyphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide (PubChem CID 108551204) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(4-hydroxyphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | 2-(4-hydroxyphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108551204 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-(4-hydroxyphenoxy)-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)NC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-14(27-18-4-2-17(24)3-5-18)19(25)22-16-8-12-23(13-9-16)20(26)15-6-10-21-11-7-15/h2-7,10-11,14,16,24H,8-9,12-13H2,1H3,(H,22,25) |
| InChIKey | FYGWRLKXGHYVOV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |