C54H54O24P6 — CID 10855283
3-[2,3,4,5,6-pentakis[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxy]cyclohexyl]oxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide (PubChem CID 10855283) has the molecular formula C54H54O24P6 and a molecular weight of 1272.85 g/mol. Its IUPAC name is 3-[2,3,4,5,6-pentakis[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxy]cyclohexyl]oxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide.
| Compound Name | 3-[2,3,4,5,6-pentakis[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxy]cyclohexyl]oxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide |
|---|---|
| PubChem CID | 10855283 |
| Molecular Formula | C54H54O24P6 |
| Molecular Weight | 1272.85 g/mol |
| Exact Mass | 1272.14 |
| IUPAC Name | 3-[2,3,4,5,6-pentakis[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxy]cyclohexyl]oxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide |
| SMILES | O=P1(OC2C(OP3(=O)OCc4ccccc4CO3)C(OP3(=O)OCc4ccccc4CO3)C(OP3(=O)OCc4ccccc4CO3)C(OP3(=O)OCc4ccccc4CO3)C2OP2(=O)OCc3ccccc3CO2)OCc2ccccc2CO1 |
| InChI | InChI=1S/C54H54O24P6/c55-79(61-25-37-13-1-2-14-38(37)26-62-79)73-49-50(74-80(56)63-27-39-15-3-4-16-40(39)28-64-80)52(76-82(58)67-31-43-19-7-8-20-44(43)32-68-82)54(78-84(60)71-35-47-23-11-12-24-48(47)36-72-84)53(77-83(59)69-33-45-21-9-10-22-46(45)34-70-83)51(49)75-81(57)65-29-41-17-5-6-18-42(41)30-66-81/h1-24,49-54H,25-36H2 |
| InChIKey | CSRABBUWVKOADV-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 268.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1272.85 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|