C26H36N2O3 — CID 108553040
N-[1-(adamantane-1-carbonyl)piperidin-4-yl]-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 108553040) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[1-(adamantane-1-carbonyl)piperidin-4-yl]-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-[1-(adamantane-1-carbonyl)piperidin-4-yl]-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108553040 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[1-(adamantane-1-carbonyl)piperidin-4-yl]-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NC2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1C |
| InChI | InChI=1S/C26H36N2O3/c1-17-3-4-23(9-18(17)2)31-16-24(29)27-22-5-7-28(8-6-22)25(30)26-13-19-10-20(14-26)12-21(11-19)15-26/h3-4,9,19-22H,5-8,10-16H2,1-2H3,(H,27,29) |
| InChIKey | LRUUBQGCFCRGDF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |