C24H29ClN2O4 — CID 108553430
N-[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 108553430) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553430 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(NC(=O)CCCOc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-17-5-8-20(9-6-17)31-15-3-4-23(28)26-19-11-13-27(14-12-19)24(29)21-16-18(25)7-10-22(21)30-2/h5-10,16,19H,3-4,11-15H2,1-2H3,(H,26,28) |
| InChIKey | XDVZNCZZWVIMCP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|