About bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde
bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde (PubChem CID 10855492) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde.
Molecular Properties
| Compound Name | bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde |
| PubChem CID | 10855492 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde |
| SMILES | O=Cc1cccc2c1CC2 |
| InChI | InChI=1S/C9H8O/c10-6-8-3-1-2-7-4-5-9(7)8/h1-3,6H,4-5H2 |
| InChIKey | GQTWBQNTBUAHGD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde?
The IUPAC name of bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde (CID 10855492) is bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde.
What is the SMILES notation for bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde?
The canonical SMILES for bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde is O=Cc1cccc2c1CC2.
What is the InChIKey of bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde?
The InChIKey is GQTWBQNTBUAHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c10-6-8-3-1-2-7-4-5-9(7)8/h1-3,6H,4-5H2.
What are the key properties of bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde?
bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde has a molecular weight of 132.16 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1(6),2,4-triene-2-carbaldehyde is sourced from PubChem (CID 10855492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).