C7H9N3 — CID 10855506
(1R,4R,5S)-5-azidobicyclo[2.2.1]hept-2-ene (PubChem CID 10855506) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is (1R,4R,5S)-5-azidobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4R,5S)-5-azidobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10855506 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | (1R,4R,5S)-5-azidobicyclo[2.2.1]hept-2-ene |
| SMILES | [N-]=[N+]=N[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C7H9N3/c8-10-9-7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | CTYUYTLJJKGKND-VQVTYTSYSA-N |
| XLogP | 2.26 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|